Compound Q&A

What industries use 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5)?

Answer

5-Bromo-6-chloro-1H-indol-3-yl butyrate
5-Bromo-6-chloro-1H-indol-3-yl butyrate finds applications in the pharmaceutical industry for the development of novel bioactive compounds. It is also used in research for synthesizing other indole derivatives, which can be utilized in various fields such as polymers, sensors, and semiconductors.

About

English Name 5-Bromo-6-chloro-1H-indol-3-yl butyrate
Molecular Formula C12H11BrClNO2
Molecular Weight 316.58 g/mol
SMILES CCCC(=O)OC1=CNC2=CC(=C(C=C21)Br)Cl
InChIKey VZAORBVTZPOGMO-UHFFFAOYSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5)?

5-Bromo-6-chloro-1H-indol-3-yl butyrate is a crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5) typically synthesized?

5-Bromo-6-chloro-1H-indol-3-yl butyrate is typically synthesized via a multistep process involving t...

Compound Q&A

What precautions should be taken when handling 5-Bromo-6-chloro-1H-indol-3-yl butyrate (CAS: 873295-29-5)?

When handling 5-Bromo-6-chloro-1H-indol-3-yl butyrate, it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...