Compound Q&A

What precautions should be taken when handling 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4)?

Answer

5-Phenyl-2,2'-bipyridine
When handling 5-Phenyl-2,2'-bipyridine, it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store it in a well-ventilated area and use a fume hood during handling to minimize exposure. Spills should be cleaned up with caution, and the Material Safety Data Sheet (MSDS) should be consulted for specific spill procedures and safety information.

About

English Name 5-Phenyl-2,2'-bipyridine
Molecular Formula C16H12N2
Molecular Weight 232.28599999999997 g/mol
SMILES C1=CC=C(C=C1)C2=CN=C(C=C2)C3=CC=CC=N3
InChIKey OPPMNBYHIZCEGC-UHFFFAOYSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4)?

5-Phenyl-2,2'-bipyridine is a crystalline solid with a molecular weight of approximately 234.3 g/mol...

Compound Q&A

How is 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4) typically synthesized?

5-Phenyl-2,2'-bipyridine is commonly synthesized via the condensation of 2,2'-bipyridine with phenyl...

Compound Q&A

What industries use 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4)?

5-Phenyl-2,2'-bipyridine is used in various industries, including pharmaceuticals for its ligand pro...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...