Compound Q&A

What are the physical and chemical properties of 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4)?

Answer

5-Phenyl-2,2'-bipyridine
5-Phenyl-2,2'-bipyridine is a crystalline solid with a molecular weight of approximately 234.3 g/mol. It has a low solubility in water (0.01 g/L at 25°C) but is more soluble in organic solvents like ethanol and acetonitrile. The compound is relatively stable, but it can react with strong oxidizing agents. It exhibits good thermal stability up to around 250°C.

About

English Name 5-Phenyl-2,2'-bipyridine
Molecular Formula C16H12N2
Molecular Weight 232.28599999999997 g/mol
SMILES C1=CC=C(C=C1)C2=CN=C(C=C2)C3=CC=CC=N3
InChIKey OPPMNBYHIZCEGC-UHFFFAOYSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

How is 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4) typically synthesized?

5-Phenyl-2,2'-bipyridine is commonly synthesized via the condensation of 2,2'-bipyridine with phenyl...

Compound Q&A

What industries use 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4)?

5-Phenyl-2,2'-bipyridine is used in various industries, including pharmaceuticals for its ligand pro...

Compound Q&A

What precautions should be taken when handling 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4)?

When handling 5-Phenyl-2,2'-bipyridine, it is important to wear appropriate personal protective equi...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...