Compound Q&A

How is 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4) typically synthesized?

Answer

5-Phenyl-2,2'-bipyridine
5-Phenyl-2,2'-bipyridine is commonly synthesized via the condensation of 2,2'-bipyridine with phenyl isocyanate in the presence of a base such as triethylamine. The reaction is carried out at room temperature, and the yield is typically around 70-80%. The use of a fume hood is essential to handle the isocyanate due to its toxicity and volatility.

About

English Name 5-Phenyl-2,2'-bipyridine
Molecular Formula C16H12N2
Molecular Weight 232.28599999999997 g/mol
SMILES C1=CC=C(C=C1)C2=CN=C(C=C2)C3=CC=CC=N3
InChIKey OPPMNBYHIZCEGC-UHFFFAOYSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4)?

5-Phenyl-2,2'-bipyridine is a crystalline solid with a molecular weight of approximately 234.3 g/mol...

Compound Q&A

What industries use 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4)?

5-Phenyl-2,2'-bipyridine is used in various industries, including pharmaceuticals for its ligand pro...

Compound Q&A

What precautions should be taken when handling 5-Phenyl-2,2'-bipyridine (CAS: 156972-80-4)?

When handling 5-Phenyl-2,2'-bipyridine, it is important to wear appropriate personal protective equi...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...