Compound Q&A

How is 3-Naphthalen-2-yl-acrylic acid methyl ester (CAS: 22837-78-1) typically synthesized?

Answer

3-Naphthalen-2-yl-acrylic acid methyl ester
3-Naphthalen-2-yl-acrylic acid methyl ester is typically synthesized by the esterification of 3-naphthalen-2-yl-acrylic acid with methanol in the presence of an acid catalyst like sulfuric acid or p-toluenesulfonic acid. The reaction is carried out at elevated temperatures, and the product is purified by recrystallization from ethanol. The yield is typically around 85%, with excellent purity and selectivity.

About

CAS No 22837-78-1
English Name 3-Naphthalen-2-yl-acrylic acid methyl ester
Molecular Formula C14H12O2
Molecular Weight 212.25 g/mol
SMILES COC(=O)C=CC1=CC2=CC=CC=C2C=C1
InChIKey LQDBRZFZGWAPEL-VQHVLOKHSA-N
Last Updated: 2026-03-28 23:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Naphthalen-2-yl-acrylic acid methyl ester (CAS: 22837-78-1)?

3-Naphthalen-2-yl-acrylic acid methyl ester is a white crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 3-Naphthalen-2-yl-acrylic acid methyl ester (CAS: 22837-78-1)?

3-Naphthalen-2-yl-acrylic acid methyl ester is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 3-Naphthalen-2-yl-acrylic acid methyl ester (CAS: 22837-78-1)?

When handling 3-Naphthalen-2-yl-acrylic acid methyl ester, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...