Compound Q&A

What are the physical and chemical properties of 3-Naphthalen-2-yl-acrylic acid methyl ester (CAS: 22837-78-1)?

Answer

3-Naphthalen-2-yl-acrylic acid methyl ester
3-Naphthalen-2-yl-acrylic acid methyl ester is a white crystalline solid with a molecular weight of approximately 252.31 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is moderately reactive towards bases and forms salts in aqueous solutions. It exhibits good stability under normal laboratory conditions but requires protection from moisture and strong acids.

About

CAS No 22837-78-1
English Name 3-Naphthalen-2-yl-acrylic acid methyl ester
Molecular Formula C14H12O2
Molecular Weight 212.25 g/mol
SMILES COC(=O)C=CC1=CC2=CC=CC=C2C=C1
InChIKey LQDBRZFZGWAPEL-VQHVLOKHSA-N
Last Updated: 2026-03-28 23:48

Related Q&A

Compound Q&A

How is 3-Naphthalen-2-yl-acrylic acid methyl ester (CAS: 22837-78-1) typically synthesized?

3-Naphthalen-2-yl-acrylic acid methyl ester is typically synthesized by the esterification of 3-naph...

Compound Q&A

What industries use 3-Naphthalen-2-yl-acrylic acid methyl ester (CAS: 22837-78-1)?

3-Naphthalen-2-yl-acrylic acid methyl ester is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 3-Naphthalen-2-yl-acrylic acid methyl ester (CAS: 22837-78-1)?

When handling 3-Naphthalen-2-yl-acrylic acid methyl ester, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...