Compound Q&A

What industries use 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1)?

Answer

2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile
2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those requiring specific functional groups. It is also utilized in the polymer industry for enhancing the properties of certain polymers. Additionally, it finds application in the production of sensors and semiconductors, where its unique chemical properties are advantageous.

About

English Name 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile
Molecular Formula C13H17N3
Molecular Weight 17.031 g/mol
SMILES CN1CCN(CC1)CC2=CC=CC=C2C#N
InChIKey SZENQRLSNAOEPP-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1)?

2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile is a colorless to light yellow liquid with a molecula...

Compound Q&A

How is 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1) typically synthesized?

2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile is synthesized via a multi-step process involving the...

Compound Q&A

What precautions should be taken when handling 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1)?

Handling 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile requires appropriate personal protective equ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...