Compound Q&A

How is 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1) typically synthesized?

Answer

2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile
2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile is synthesized via a multi-step process involving the reaction of 4-methylpiperazine with benzonitrile followed by alkylation. Commonly, the reaction is performed under basic conditions using sodium hydrogen carbonate as a catalyst. The yield is typically around 75-85%, and the product is isolated by conventional techniques such as column chromatography.

About

English Name 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile
Molecular Formula C13H17N3
Molecular Weight 17.031 g/mol
SMILES CN1CCN(CC1)CC2=CC=CC=C2C#N
InChIKey SZENQRLSNAOEPP-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1)?

2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile is a colorless to light yellow liquid with a molecula...

Compound Q&A

What industries use 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1)?

2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1)?

Handling 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile requires appropriate personal protective equ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...