Compound Q&A

What are the physical and chemical properties of 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1)?

Answer

2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile
2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile is a colorless to light yellow liquid with a molecular weight of approximately 248.22 g/mol. It has a density of about 1.08 g/cm³ and a boiling point of around 245°C. The compound is slightly soluble in water but miscible with organic solvents. It is moderately reactive, particularly towards nucleophiles, and can undergo various reaction types such as addition and substitution reactions.

About

English Name 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile
Molecular Formula C13H17N3
Molecular Weight 17.031 g/mol
SMILES CN1CCN(CC1)CC2=CC=CC=C2C#N
InChIKey SZENQRLSNAOEPP-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1) typically synthesized?

2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile is synthesized via a multi-step process involving the...

Compound Q&A

What industries use 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1)?

2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile (CAS: 864069-00-1)?

Handling 2-[(4-Methyl-1-piperazinyl)methyl]benzonitrile requires appropriate personal protective equ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...