Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4)?

Answer

Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate
Handling Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate requires appropriate personal protective equipment (PPE), including gloves, safety glasses, and a lab coat. The compound should be handled in a well-ventilated area or under a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbent materials, and proper disposal methods should be followed. Always refer to the safety data sheet (SDS) for detailed handling and emergency procedures.

About

English Name Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate
Molecular Formula C18H35N3O4
Molecular Weight 357.49 g/mol
SMILES CC(C)(C)OC(=O)CN1CCNCCN(CC1)CC(=O)OC(C)(C)C
InChIKey KAGBCHRKKXTZOY-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4)?

Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate is a white crystalline solid with...

Compound Q&A

How is Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4) typically synthesized?

Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate is usually synthesized through an...

Compound Q&A

What industries use Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4)?

Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate is primarily used in the pharmace...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...