Compound Q&A

What industries use Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4)?

Answer

Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate
Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate is primarily used in the pharmaceutical and polymer industries. It serves as a key intermediate in the synthesis of various medicinals and is also used in the production of polyurethane-based materials. Additionally, it has applications in the development of sensors and electronic devices due to its unique chemical properties.

About

English Name Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate
Molecular Formula C18H35N3O4
Molecular Weight 357.49 g/mol
SMILES CC(C)(C)OC(=O)CN1CCNCCN(CC1)CC(=O)OC(C)(C)C
InChIKey KAGBCHRKKXTZOY-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4)?

Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate is a white crystalline solid with...

Compound Q&A

How is Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4) typically synthesized?

Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate is usually synthesized through an...

Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4)?

Handling Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate requires appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...