Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4)?

Answer

Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate
Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate is a white crystalline solid with a molecular weight of approximately 324.37 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetonitrile. The compound is relatively stable, but it is sensitive to strong oxidizing agents. It does not react readily with common reagents but can undergo acid-catalyzed hydrolysis under basic conditions.

About

English Name Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate
Molecular Formula C18H35N3O4
Molecular Weight 357.49 g/mol
SMILES CC(C)(C)OC(=O)CN1CCNCCN(CC1)CC(=O)OC(C)(C)C
InChIKey KAGBCHRKKXTZOY-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4) typically synthesized?

Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate is usually synthesized through an...

Compound Q&A

What industries use Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4)?

Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate (CAS: 174137-97-4)?

Handling Bis(2-methyl-2-propanyl) 2,2'-(1,4,7-triazonane-1,4-diyl)diacetate requires appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...