Compound Q&A

What industries use (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2)?

Answer

(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (1:1)
(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride is primarily used in the pharmaceutical industry as an intermediate for the synthesis of drugs. It is also utilized in the development of materials for sensors and semiconductors, due to its unique chemical structure and reactivity. Its use in polymer chemistry is also explored for its potential applications in functional polymers.

About

English Name (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (1:1)
Molecular Formula C10H13BrClN
Molecular Weight 262.58 g/mol
SMILES Brc1cccc(c1)[C@H]1CCCN1.Cl
InChIKey CVYQYZJNUFUMJY-HNCPQSOCSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2)?

(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride is a crystalline compound with a molecular weight of...

Compound Q&A

How is (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2) typically synthesized?

(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride is typically synthesized through the reaction of 3-b...

Compound Q&A

What precautions should be taken when handling (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2)?

When handling (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride, it is important to use appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...