Compound Q&A

What are the physical and chemical properties of (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2)?

Answer

(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (1:1)
(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride is a crystalline compound with a molecular weight of approximately 294.07 g/mol. It is sparingly soluble in water but soluble in organic solvents like methanol and ethanol. This compound has limited reactivity under normal conditions, but it can undergo substitution reactions under appropriate conditions. Its hydrochloride salt form is commonly used due to its stability and solubility characteristics.

About

English Name (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (1:1)
Molecular Formula C10H13BrClN
Molecular Weight 262.58 g/mol
SMILES Brc1cccc(c1)[C@H]1CCCN1.Cl
InChIKey CVYQYZJNUFUMJY-HNCPQSOCSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

How is (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2) typically synthesized?

(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride is typically synthesized through the reaction of 3-b...

Compound Q&A

What industries use (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2)?

(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride is primarily used in the pharmaceutical industry as ...

Compound Q&A

What precautions should be taken when handling (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2)?

When handling (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride, it is important to use appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...