Compound Q&A

How is (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2) typically synthesized?

Answer

(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (1:1)
(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride is typically synthesized through the reaction of 3-bromophenylboronic acid with pyrrolidine in the presence of a palladium catalyst and a base. The reaction conditions, such as the choice of catalyst and base, can significantly affect the yield and selectivity. This method is commonly used in the organic synthesis industry to produce this compound with good efficiency.

About

English Name (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (1:1)
Molecular Formula C10H13BrClN
Molecular Weight 262.58 g/mol
SMILES Brc1cccc(c1)[C@H]1CCCN1.Cl
InChIKey CVYQYZJNUFUMJY-HNCPQSOCSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2)?

(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride is a crystalline compound with a molecular weight of...

Compound Q&A

What industries use (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2)?

(2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride is primarily used in the pharmaceutical industry as ...

Compound Q&A

What precautions should be taken when handling (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride (CAS: 1391550-13-2)?

When handling (2R)-2-(3-Bromophenyl)pyrrolidine hydrochloride, it is important to use appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...