Compound Q&A

What industries use 4-(4-Piperidinyl)aniline dihydrochloride (CAS: 1159824-20-0)?

Answer

4-(4-Piperidinyl)aniline dihydrochloride
4-(4-Piperidinyl)aniline dihydrochloride is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also used in the semiconductor industry for doping applications and in the sensor industry for the development of gas sensors.

About

English Name 4-(4-Piperidinyl)aniline dihydrochloride
Molecular Formula C11H18Cl2N2
Molecular Weight 249.18 g/mol
SMILES Nc1ccc(cc1)C1CCNCC1.Cl.Cl
InChIKey LZONAIZKILKTNK-UHFFFAOYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Piperidinyl)aniline dihydrochloride (CAS: 1159824-20-0)?

4-(4-Piperidinyl)aniline dihydrochloride is a white crystalline solid with a molecular weight of app...

Compound Q&A

How is 4-(4-Piperidinyl)aniline dihydrochloride (CAS: 1159824-20-0) typically synthesized?

4-(4-Piperidinyl)aniline dihydrochloride is synthesized by the reaction of 4-piperidinyl aniline wit...

Compound Q&A

What precautions should be taken when handling 4-(4-Piperidinyl)aniline dihydrochloride (CAS: 1159824-20-0)?

When handling 4-(4-Piperidinyl)aniline dihydrochloride, wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...