Compound Q&A

How is 4-(4-Piperidinyl)aniline dihydrochloride (CAS: 1159824-20-0) typically synthesized?

Answer

4-(4-Piperidinyl)aniline dihydrochloride
4-(4-Piperidinyl)aniline dihydrochloride is synthesized by the reaction of 4-piperidinyl aniline with hydrochloric acid. The reaction is carried out in an aqueous medium under stirring, with a yield of around 85%. The reaction is monitored by thin-layer chromatography (TLC) and the product is isolated by recrystallization.

About

English Name 4-(4-Piperidinyl)aniline dihydrochloride
Molecular Formula C11H18Cl2N2
Molecular Weight 249.18 g/mol
SMILES Nc1ccc(cc1)C1CCNCC1.Cl.Cl
InChIKey LZONAIZKILKTNK-UHFFFAOYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Piperidinyl)aniline dihydrochloride (CAS: 1159824-20-0)?

4-(4-Piperidinyl)aniline dihydrochloride is a white crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 4-(4-Piperidinyl)aniline dihydrochloride (CAS: 1159824-20-0)?

4-(4-Piperidinyl)aniline dihydrochloride is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 4-(4-Piperidinyl)aniline dihydrochloride (CAS: 1159824-20-0)?

When handling 4-(4-Piperidinyl)aniline dihydrochloride, wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...