Compound Q&A

What precautions should be taken when handling Lewis B tetrasaccharide (CAS: 80081-06-7)?

Answer

Lewis B tetrasaccharide
When handling Lewis B tetrasaccharide, it is important to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to prevent inhalation. Spills should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and storage instructions.

About

CAS No 80081-06-7
English Name Lewis B tetrasaccharide
Molecular Formula C26H45NO19
Molecular Weight 675.63 g/mol
SMILES CC1C(C(C(C(O1)OC2C(OC(C(C2OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)C)O)O)O)NC(=O)C)O)CO)O)O)O
InChIKey OXNGKCPRVRBHPO-UHFFFAOYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lewis B tetrasaccharide (CAS: 80081-06-7)?

Lewis B tetrasaccharide is a white crystalline solid with a molecular weight of approximately 612.3 ...

Compound Q&A

How is Lewis B tetrasaccharide (CAS: 80081-06-7) typically synthesized?

Lewis B tetrasaccharide is typically synthesized through a series of glycosylation reactions using a...

Compound Q&A

What industries use Lewis B tetrasaccharide (CAS: 80081-06-7)?

Lewis B tetrasaccharide is primarily used in the pharmaceutical industry for the development of anti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...