Compound Q&A

How is Lewis B tetrasaccharide (CAS: 80081-06-7) typically synthesized?

Answer

Lewis B tetrasaccharide
Lewis B tetrasaccharide is typically synthesized through a series of glycosylation reactions using activated sugars and a Mitsunobu reaction as a key step. The synthesis involves the use of triphenylphosphine and diisopropyl azodicarboxylate as the reducing reagent, yielding a product with high selectivity and good yield.

About

CAS No 80081-06-7
English Name Lewis B tetrasaccharide
Molecular Formula C26H45NO19
Molecular Weight 675.63 g/mol
SMILES CC1C(C(C(C(O1)OC2C(OC(C(C2OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)C)O)O)O)NC(=O)C)O)CO)O)O)O
InChIKey OXNGKCPRVRBHPO-UHFFFAOYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lewis B tetrasaccharide (CAS: 80081-06-7)?

Lewis B tetrasaccharide is a white crystalline solid with a molecular weight of approximately 612.3 ...

Compound Q&A

What industries use Lewis B tetrasaccharide (CAS: 80081-06-7)?

Lewis B tetrasaccharide is primarily used in the pharmaceutical industry for the development of anti...

Compound Q&A

What precautions should be taken when handling Lewis B tetrasaccharide (CAS: 80081-06-7)?

When handling Lewis B tetrasaccharide, it is important to use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...