Compound Q&A

What industries use Lewis B tetrasaccharide (CAS: 80081-06-7)?

Answer

Lewis B tetrasaccharide
Lewis B tetrasaccharide is primarily used in the pharmaceutical industry for the development of antimicrobial agents and in the production of certain drugs. It also finds applications in the polymer industry for the synthesis of biodegradable polymers and in the biotechnology sector for affinity chromatography and diagnostics.

About

CAS No 80081-06-7
English Name Lewis B tetrasaccharide
Molecular Formula C26H45NO19
Molecular Weight 675.63 g/mol
SMILES CC1C(C(C(C(O1)OC2C(OC(C(C2OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)C)O)O)O)NC(=O)C)O)CO)O)O)O
InChIKey OXNGKCPRVRBHPO-UHFFFAOYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lewis B tetrasaccharide (CAS: 80081-06-7)?

Lewis B tetrasaccharide is a white crystalline solid with a molecular weight of approximately 612.3 ...

Compound Q&A

How is Lewis B tetrasaccharide (CAS: 80081-06-7) typically synthesized?

Lewis B tetrasaccharide is typically synthesized through a series of glycosylation reactions using a...

Compound Q&A

What precautions should be taken when handling Lewis B tetrasaccharide (CAS: 80081-06-7)?

When handling Lewis B tetrasaccharide, it is important to use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...