Compound Q&A

What industries use 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4)?

Answer

4,5-Dichloro-1H-indole-2-carboxylic acid
4,5-Dichloro-1H-indole-2-carboxylic acid is primarily used in the pharmaceutical industry for the synthesis of bioactive compounds. It is also utilized in the production of organic sensors and in the development of certain polymers and semiconductors.

About

English Name 4,5-Dichloro-1H-indole-2-carboxylic acid
Molecular Formula C9H5Cl2NO2
Molecular Weight 230.05 g/mol
SMILES OC(=O)c1cc2c(Cl)c(Cl)ccc2[nH]1
InChIKey STMAOBOTFAMOLD-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4)?

4,5-Dichloro-1H-indole-2-carboxylic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4) typically synthesized?

4,5-Dichloro-1H-indole-2-carboxylic acid is synthesized through a multi-step process involving the c...

Compound Q&A

What precautions should be taken when handling 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4)?

When handling 4,5-Dichloro-1H-indole-2-carboxylic acid, appropriate personal protective equipment (P...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...