Compound Q&A

How is 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4) typically synthesized?

Answer

4,5-Dichloro-1H-indole-2-carboxylic acid
4,5-Dichloro-1H-indole-2-carboxylic acid is synthesized through a multi-step process involving the condensation of indole with chloromethyl ketones, followed by treatment with hydrochloric acid. The reaction typically yields a high purity product with good selectivity and a yield of around 80-90%.

About

English Name 4,5-Dichloro-1H-indole-2-carboxylic acid
Molecular Formula C9H5Cl2NO2
Molecular Weight 230.05 g/mol
SMILES OC(=O)c1cc2c(Cl)c(Cl)ccc2[nH]1
InChIKey STMAOBOTFAMOLD-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4)?

4,5-Dichloro-1H-indole-2-carboxylic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4)?

4,5-Dichloro-1H-indole-2-carboxylic acid is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4)?

When handling 4,5-Dichloro-1H-indole-2-carboxylic acid, appropriate personal protective equipment (P...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...