Compound Q&A

What are the physical and chemical properties of 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4)?

Answer

4,5-Dichloro-1H-indole-2-carboxylic acid
4,5-Dichloro-1H-indole-2-carboxylic acid is a crystalline solid with a molecular weight of approximately 240.02 g/mol. It has a low water solubility, around 0.05 g/L. This compound is relatively stable under normal conditions but can react with bases to form salts. It is not reactive with common acids and is inert towards most organic reagents.

About

English Name 4,5-Dichloro-1H-indole-2-carboxylic acid
Molecular Formula C9H5Cl2NO2
Molecular Weight 230.05 g/mol
SMILES OC(=O)c1cc2c(Cl)c(Cl)ccc2[nH]1
InChIKey STMAOBOTFAMOLD-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4) typically synthesized?

4,5-Dichloro-1H-indole-2-carboxylic acid is synthesized through a multi-step process involving the c...

Compound Q&A

What industries use 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4)?

4,5-Dichloro-1H-indole-2-carboxylic acid is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 4,5-Dichloro-1H-indole-2-carboxylic acid (CAS: 231295-84-4)?

When handling 4,5-Dichloro-1H-indole-2-carboxylic acid, appropriate personal protective equipment (P...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...