Compound Q&A

What precautions should be taken when handling (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

Answer

(S,R,S)-Ahpc-C10-NH2
When handling (S,R,S)-Ahpc-C10-NH2, it is crucial to follow safety guidelines. Wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store the compound in a cool, dry place away from strong acids and bases. In case of a spill, contain it using absorbent material and dispose of it according to local regulations. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name (S,R,S)-Ahpc-C10-NH2
Molecular Formula C33H51N5O4S
Molecular Weight 613.85 g/mol
SMILES S1C=NC(C)=C1C1C=CC(=CC=1)CNC([C@@H]1C[C@H](CN1C([C@H](C(C)(C)C)NC(CCCCCCCCCCN)=O)=O)O)=O
InChIKey PZWKSXPBEBWQQH-HRHHFINDSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

(S,R,S)-Ahpc-C10-NH2 is a chiral compound with a complex molecular structure. It typically crystalli...

Compound Q&A

How is (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3) typically synthesized?

(S,R,S)-Ahpc-C10-NH2 is usually synthesized via a multistep process involving the use of chiral auxi...

Compound Q&A

What industries use (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

(S,R,S)-Ahpc-C10-NH2 is used in various industries, particularly in pharmaceuticals where its chiral...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...