Compound Q&A

How is (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3) typically synthesized?

Answer

(S,R,S)-Ahpc-C10-NH2
(S,R,S)-Ahpc-C10-NH2 is usually synthesized via a multistep process involving the use of chiral auxiliaries and asymmetric catalysis. The synthesis often requires the use of Lewis acids and transition metal catalysts to achieve high enantioselectivity. The overall yield can vary from 50% to 70%, depending on the specific conditions and purity of the starting materials.

About

English Name (S,R,S)-Ahpc-C10-NH2
Molecular Formula C33H51N5O4S
Molecular Weight 613.85 g/mol
SMILES S1C=NC(C)=C1C1C=CC(=CC=1)CNC([C@@H]1C[C@H](CN1C([C@H](C(C)(C)C)NC(CCCCCCCCCCN)=O)=O)O)=O
InChIKey PZWKSXPBEBWQQH-HRHHFINDSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

(S,R,S)-Ahpc-C10-NH2 is a chiral compound with a complex molecular structure. It typically crystalli...

Compound Q&A

What industries use (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

(S,R,S)-Ahpc-C10-NH2 is used in various industries, particularly in pharmaceuticals where its chiral...

Compound Q&A

What precautions should be taken when handling (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

When handling (S,R,S)-Ahpc-C10-NH2, it is crucial to follow safety guidelines. Wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...