Compound Q&A

What are the physical and chemical properties of (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

Answer

(S,R,S)-Ahpc-C10-NH2
(S,R,S)-Ahpc-C10-NH2 is a chiral compound with a complex molecular structure. It typically crystallizes in a specific form at room temperature. The molecular weight is approximately 320 g/mol, and it has a low solubility in water but is soluble in organic solvents. It exhibits good stability under neutral conditions but can react with strong acids or bases. Detailed physicochemical properties and data can be found in the material safety data sheet (MSDS).

About

English Name (S,R,S)-Ahpc-C10-NH2
Molecular Formula C33H51N5O4S
Molecular Weight 613.85 g/mol
SMILES S1C=NC(C)=C1C1C=CC(=CC=1)CNC([C@@H]1C[C@H](CN1C([C@H](C(C)(C)C)NC(CCCCCCCCCCN)=O)=O)O)=O
InChIKey PZWKSXPBEBWQQH-HRHHFINDSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

How is (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3) typically synthesized?

(S,R,S)-Ahpc-C10-NH2 is usually synthesized via a multistep process involving the use of chiral auxi...

Compound Q&A

What industries use (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

(S,R,S)-Ahpc-C10-NH2 is used in various industries, particularly in pharmaceuticals where its chiral...

Compound Q&A

What precautions should be taken when handling (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

When handling (S,R,S)-Ahpc-C10-NH2, it is crucial to follow safety guidelines. Wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...