Compound Q&A

What industries use (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

Answer

(S,R,S)-Ahpc-C10-NH2
(S,R,S)-Ahpc-C10-NH2 is used in various industries, particularly in pharmaceuticals where its chiral nature is exploited for drug development. It is also utilized in the production of chiral sensors and in the synthesis of certain polymers. Its potential applications in semiconductors and other advanced materials are being explored but are still in the research phase.

About

English Name (S,R,S)-Ahpc-C10-NH2
Molecular Formula C33H51N5O4S
Molecular Weight 613.85 g/mol
SMILES S1C=NC(C)=C1C1C=CC(=CC=1)CNC([C@@H]1C[C@H](CN1C([C@H](C(C)(C)C)NC(CCCCCCCCCCN)=O)=O)O)=O
InChIKey PZWKSXPBEBWQQH-HRHHFINDSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

(S,R,S)-Ahpc-C10-NH2 is a chiral compound with a complex molecular structure. It typically crystalli...

Compound Q&A

How is (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3) typically synthesized?

(S,R,S)-Ahpc-C10-NH2 is usually synthesized via a multistep process involving the use of chiral auxi...

Compound Q&A

What precautions should be taken when handling (S,R,S)-Ahpc-C10-NH2 (CAS: 2341796-74-3)?

When handling (S,R,S)-Ahpc-C10-NH2, it is crucial to follow safety guidelines. Wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...