Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

Answer

2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
When handling this compound, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a cool, dry place away from direct sunlight. Handling should occur in a well-ventilated area or under a fume hood. Spills should be managed carefully, and the Material Safety Data Sheet (MSDS) should be consulted for specific instructions. This compound is toxic and corrosive, so proper disposal methods should be followed.

About

English Name 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
Molecular Formula C13H23ClO4
Molecular Weight 278.78 g/mol
SMILES CC1(O[C@@H](C[C@@H](O1)CCl)CC(=O)OC(C)(C)C)C
InChIKey TXLXWCARAPIXGH-VHSXEESVSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate is a colorless li...

Compound Q&A

How is 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9) typically synthesized?

This compound is typically synthesized via a Wittig reaction between the appropriate aldehyde and th...

Compound Q&A

What industries use 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

This compound is used in various industries, including pharmaceuticals for its role as an intermedia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...