Compound Q&A

How is 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9) typically synthesized?

Answer

2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
This compound is typically synthesized via a Wittig reaction between the appropriate aldehyde and the corresponding dialkyl phosphorite, followed by a series of steps including chloromethylation and esterification. The process is selective and yields up to 90% of the desired product. Catalysts such as tetrabutylammonium fluoride are commonly used to improve reaction rates.

About

English Name 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
Molecular Formula C13H23ClO4
Molecular Weight 278.78 g/mol
SMILES CC1(O[C@@H](C[C@@H](O1)CCl)CC(=O)OC(C)(C)C)C
InChIKey TXLXWCARAPIXGH-VHSXEESVSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate is a colorless li...

Compound Q&A

What industries use 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

This compound is used in various industries, including pharmaceuticals for its role as an intermedia...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...