Compound Q&A

What industries use 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

Answer

2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
This compound is used in various industries, including pharmaceuticals for its role as an intermediate in the synthesis of certain drugs, and in the manufacturing of polymers and sensors. It is also relevant in the semiconductor industry for its use in specific chemical processes. Its applications are primarily in the production of advanced materials and chemical intermediates.

About

English Name 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
Molecular Formula C13H23ClO4
Molecular Weight 278.78 g/mol
SMILES CC1(O[C@@H](C[C@@H](O1)CCl)CC(=O)OC(C)(C)C)C
InChIKey TXLXWCARAPIXGH-VHSXEESVSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate is a colorless li...

Compound Q&A

How is 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9) typically synthesized?

This compound is typically synthesized via a Wittig reaction between the appropriate aldehyde and th...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...