Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

Answer

2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate is a colorless liquid with a molecular weight of 334.03 g/mol. It has a specific gravity of 1.03 and is soluble in organic solvents such as ethanol and acetone. Chemically, it is reactive and prone to hydrolysis under acidic conditions. It is also sensitive to light and should be stored in a dark, cool place.

About

English Name 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
Molecular Formula C13H23ClO4
Molecular Weight 278.78 g/mol
SMILES CC1(O[C@@H](C[C@@H](O1)CCl)CC(=O)OC(C)(C)C)C
InChIKey TXLXWCARAPIXGH-VHSXEESVSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9) typically synthesized?

This compound is typically synthesized via a Wittig reaction between the appropriate aldehyde and th...

Compound Q&A

What industries use 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

This compound is used in various industries, including pharmaceuticals for its role as an intermedia...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS: 521973-99-9)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...