Compound Q&A

What precautions should be taken when handling 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

Answer

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid
When handling 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid, it is important to wear appropriate personal protective equipment (PPE), such as gloves and safety goggles. The compound should be stored in a well-ventilated area and handled in a fume hood to minimize inhalation risks. In case of spills, immediate cleanup should be performed using appropriate absorbents, and the area should be properly ventilated. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid
Molecular Formula C7H10N2O3
Molecular Weight 170.17 g/mol
SMILES CC(C)(C)C1=NC(=NO1)C(=O)O
InChIKey FHJXCPARNFHMSZ-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is a white crystalline solid with a molecular weight...

Compound Q&A

How is 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9) typically synthesized?

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is typically synthesized by reacting tert-butyl isot...

Compound Q&A

What industries use 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is used in various industries, including pharmaceuti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...