Compound Q&A

How is 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9) typically synthesized?

Answer

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid
5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is typically synthesized by reacting tert-butyl isothiocyanate with sodium oxalyl hydrazide. The reaction is conducted in a suitable solvent, often dimethylformamide (DMF). The process involves the formation of an intermediate isothiocyanate, followed by its reaction with sodium oxalyl hydrazide to yield the final product. Yield is generally around 70-80%.

About

English Name 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid
Molecular Formula C7H10N2O3
Molecular Weight 170.17 g/mol
SMILES CC(C)(C)C1=NC(=NO1)C(=O)O
InChIKey FHJXCPARNFHMSZ-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is a white crystalline solid with a molecular weight...

Compound Q&A

What industries use 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is used in various industries, including pharmaceuti...

Compound Q&A

What precautions should be taken when handling 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

When handling 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...