Compound Q&A

What are the physical and chemical properties of 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

Answer

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid
5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is a white crystalline solid with a molecular weight of approximately 206.25 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and acetone. The compound shows moderate reactivity, particularly in acid and base catalysis, and its thermal stability is good up to 150°C.

About

English Name 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid
Molecular Formula C7H10N2O3
Molecular Weight 170.17 g/mol
SMILES CC(C)(C)C1=NC(=NO1)C(=O)O
InChIKey FHJXCPARNFHMSZ-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9) typically synthesized?

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is typically synthesized by reacting tert-butyl isot...

Compound Q&A

What industries use 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is used in various industries, including pharmaceuti...

Compound Q&A

What precautions should be taken when handling 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

When handling 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...