Compound Q&A

What industries use 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

Answer

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid
5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is used in various industries, including pharmaceuticals for its potential as a precursor in drug synthesis, and in the production of polymers where it serves as a monomer. It also finds application in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid
Molecular Formula C7H10N2O3
Molecular Weight 170.17 g/mol
SMILES CC(C)(C)C1=NC(=NO1)C(=O)O
InChIKey FHJXCPARNFHMSZ-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is a white crystalline solid with a molecular weight...

Compound Q&A

How is 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9) typically synthesized?

5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid is typically synthesized by reacting tert-butyl isot...

Compound Q&A

What precautions should be taken when handling 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid (CAS: 748743-73-9)?

When handling 5-Tert-butyl-1,2,4-oxadiazole-3-carboxylic acid, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...