Compound Q&A

What industries use Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4)?

Answer

Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate
Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) is primarily used in the pharmaceutical industry for the synthesis of intermediates and raw materials. It is also used in some specialized applications in the polymer and sensor industries due to its unique chemical properties.

About

CAS No 72701-63-4
English Name Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate
Molecular Formula C10H8ClN3O4
Molecular Weight 269.64 g/mol
SMILES CCOC(=O)C1=C(C(=NC(=C1[N+](=O)[O-])C)Cl)C#N
InChIKey SEHVSYSJEKTOTF-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4)?

Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) is a crystalline compound wit...

Compound Q&A

How is Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) typically synthesized?

Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) is typically synthesized via ...

Compound Q&A

What precautions should be taken when handling Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4)?

When handling Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4), appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...