Compound Q&A

How is Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) typically synthesized?

Answer

Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate
Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) is typically synthesized via a multi-step process involving acylation, nitration, and chlorination reactions. These reactions are usually conducted under mild conditions and catalyzed by appropriate reagents to ensure high selectivity and yield.

About

CAS No 72701-63-4
English Name Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate
Molecular Formula C10H8ClN3O4
Molecular Weight 269.64 g/mol
SMILES CCOC(=O)C1=C(C(=NC(=C1[N+](=O)[O-])C)Cl)C#N
InChIKey SEHVSYSJEKTOTF-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4)?

Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) is a crystalline compound wit...

Compound Q&A

What industries use Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4)?

Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4)?

When handling Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4), appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...