Compound Q&A

What are the physical and chemical properties of Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4)?

Answer

Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate
Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) is a crystalline compound with a molecular weight of approximately 284.69 g/mol. It has a high solubility in organic solvents such as acetone and ethanol. The compound is relatively stable but can react with strong bases and acids. It has a melting point around 130°C and a boiling point around 260°C under reduced pressure.

About

CAS No 72701-63-4
English Name Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate
Molecular Formula C10H8ClN3O4
Molecular Weight 269.64 g/mol
SMILES CCOC(=O)C1=C(C(=NC(=C1[N+](=O)[O-])C)Cl)C#N
InChIKey SEHVSYSJEKTOTF-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) typically synthesized?

Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) is typically synthesized via ...

Compound Q&A

What industries use Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4)?

Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4) is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4)?

When handling Ethyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate (CAS: 72701-63-4), appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...