Compound Q&A

What industries use 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9)?

Answer

4-[(3-Nitrophenyl)sulfonyl]morpholine
4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) finds applications in various industries, particularly in pharmaceuticals for synthesis of medicinal compounds. It is also utilized in the synthesis of polymers and sensors due to its functional groups. The compound's reactivity towards bases makes it suitable for use in organic synthesis protocols, contributing to advancements in materials science and chemical engineering.

About

CAS No 91619-33-9
English Name 4-[(3-Nitrophenyl)sulfonyl]morpholine
Molecular Formula C10H12N2O5S
Molecular Weight 272.28 g/mol
SMILES C1COCCN1S(=O)(=O)C2=CC=CC(=C2)[N+](=O)[O-]
InChIKey XCYXNNGNLAIXNM-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9)?

4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) is a crystalline solid with a molecular weig...

Compound Q&A

How is 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) typically synthesized?

4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) is typically synthesized via a multi-step pr...

Compound Q&A

What precautions should be taken when handling 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9)?

When handling 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...