Compound Q&A

How is 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) typically synthesized?

Answer

4-[(3-Nitrophenyl)sulfonyl]morpholine
4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) is typically synthesized via a multi-step process, starting with morpholine and 3-nitrophenylsulfonyl chloride. The reaction involves the substitution of a morpholine ring with a 3-nitrophenylsulfonyl group. The yield is generally around 80-85%, and the reaction is typically performed under anhydrous conditions to avoid hydrolysis. Anhydrous solvents like pyridine are commonly used as catalysts.

About

CAS No 91619-33-9
English Name 4-[(3-Nitrophenyl)sulfonyl]morpholine
Molecular Formula C10H12N2O5S
Molecular Weight 272.28 g/mol
SMILES C1COCCN1S(=O)(=O)C2=CC=CC(=C2)[N+](=O)[O-]
InChIKey XCYXNNGNLAIXNM-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9)?

4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) is a crystalline solid with a molecular weig...

Compound Q&A

What industries use 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9)?

4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) finds applications in various industries, pa...

Compound Q&A

What precautions should be taken when handling 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9)?

When handling 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...