Compound Q&A

What are the physical and chemical properties of 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9)?

Answer

4-[(3-Nitrophenyl)sulfonyl]morpholine
4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) is a crystalline solid with a molecular weight of approximately 322.15 g/mol. It has a melting point of 165-167°C and is slightly soluble in water. It is reactive towards bases and may undergo hydrolysis. This compound exhibits good solubility in common organic solvents like methanol and acetonitrile. It is used in organic synthesis due to its sulfonyl group reactivity.

About

CAS No 91619-33-9
English Name 4-[(3-Nitrophenyl)sulfonyl]morpholine
Molecular Formula C10H12N2O5S
Molecular Weight 272.28 g/mol
SMILES C1COCCN1S(=O)(=O)C2=CC=CC(=C2)[N+](=O)[O-]
InChIKey XCYXNNGNLAIXNM-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

How is 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) typically synthesized?

4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) is typically synthesized via a multi-step pr...

Compound Q&A

What industries use 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9)?

4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9) finds applications in various industries, pa...

Compound Q&A

What precautions should be taken when handling 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9)?

When handling 4-[(3-Nitrophenyl)sulfonyl]morpholine (CAS: 91619-33-9), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...