Compound Q&A

What industries use Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6)?

Answer

Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate
Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate is used in the pharmaceutical industry for the synthesis of certain drugs, as well as in the polymer industry for the production of functional polymers with specific properties. It also finds applications in the development of sensors and as a monomer in semiconductor materials.

About

English Name Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate
Molecular Formula C11H11FO3
Molecular Weight 210.20399999999998 g/mol
SMILES CCOC(=O)C=CC1=C(C=CC(=C1)F)O
InChIKey WPJUITWUKANQHJ-ZZXKWVIFSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6)?

Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate is a colorless to pale yellow liquid with a molecula...

Compound Q&A

How is Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6) typically synthesized?

Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate is synthesized through the reaction of 5-fluoro-2-hy...

Compound Q&A

What precautions should be taken when handling Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What are the physical and chemical properties of Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is a crystalline soli...

69604-00-8Ethyl 5-nitro-1-benz...
2296719-34-9N-{3-[({2-[(4-Hydrox...
Compound Q&A

How should waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) be handled?

Waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) sho...

13933-31-8Tetraamminepalladium...
Compound Q&A

What are the main uses of 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4)?

This compound is primarily used in organic synthesis, particularly for the prepa...

1270030-08-42-[7-(tert-Butyl)pyr...