Compound Q&A

How is Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6) typically synthesized?

Answer

Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate
Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate is synthesized through the reaction of 5-fluoro-2-hydroxybenzaldehyde with acryloyl chloride in the presence of a Lewis acid catalyst, such as aluminum trichloride. The reaction yields a high yield of the desired product with good selectivity.

About

English Name Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate
Molecular Formula C11H11FO3
Molecular Weight 210.20399999999998 g/mol
SMILES CCOC(=O)C=CC1=C(C=CC(=C1)F)O
InChIKey WPJUITWUKANQHJ-ZZXKWVIFSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6)?

Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate is a colorless to pale yellow liquid with a molecula...

Compound Q&A

What industries use Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6)?

Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What are the physical and chemical properties of Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is a crystalline soli...

69604-00-8Ethyl 5-nitro-1-benz...
2296719-34-9N-{3-[({2-[(4-Hydrox...
Compound Q&A

How should waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) be handled?

Waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) sho...

13933-31-8Tetraamminepalladium...
Compound Q&A

What are the main uses of 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4)?

This compound is primarily used in organic synthesis, particularly for the prepa...

1270030-08-42-[7-(tert-Butyl)pyr...