Compound Q&A

What are the main uses of 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4)?

Answer

2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
This compound is primarily used in organic synthesis, particularly for the preparation of boronic acids and esters. It also finds applications in material science, where its unique properties are utilized in the development of novel materials. Additionally, it can be used as a building block in the synthesis of other organic compounds with specific functional groups.

About

English Name 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Molecular Formula C26H29BO2
Molecular Weight 384.32800000000015 g/mol
SMILES CC1(C)OB(OC1(C)C)c1cc2ccc3c4c2c(c1)ccc4cc(c3)C(C)(C)C
InChIKey KZUKZYBHDUDEHR-UHFFFAOYSA-N
Last Updated: 2026-01-06 17:15

Related Q&A

Compound Q&A

What is 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4)?

2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a complex organic compound w...

Compound Q&A

Is 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4) safe?

The compound is generally considered safe when handled with proper precautions. However, it should b...

Compound Q&A

How should 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4) be stored?

This compound should be stored in a cool, dry place, away from heat and sources of ignition. It is r...

Compound Q&A

What are the physical and chemical properties of Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is a crystalline soli...

69604-00-8Ethyl 5-nitro-1-benz...
2296719-34-9N-{3-[({2-[(4-Hydrox...
Compound Q&A

How should waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) be handled?

Waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) sho...

13933-31-8Tetraamminepalladium...
Compound Q&A

What are the main uses of 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4)?

This compound is primarily used in organic synthesis, particularly for the prepa...

1270030-08-42-[7-(tert-Butyl)pyr...