Compound Q&A

What are the physical and chemical properties of Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Answer

Ethyl 5-nitro-1-benzofuran-2-carboxylate
Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is a crystalline solid with a molecular weight of approximately 248.15 g/mol. It has a melting point of about 95-97°C and is slightly soluble in water. This compound is known for its reactivity, particularly in nucleophilic substitution and condensation reactions.

About

CAS No 69604-00-8
English Name Ethyl 5-nitro-1-benzofuran-2-carboxylate
Molecular Formula C11H9NO5
Molecular Weight 235.2 g/mol
SMILES CCOC(=O)C1=CC2=C(O1)C=CC(=C2)[N+](=O)[O-]
InChIKey ATHBGWVHAWGMAL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) typically synthesized?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) can be synthesized through the nitration ...

Compound Q&A

What industries use Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

When handling Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8), it is essential to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...