Compound Q&A

What are the physical and chemical properties of Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6)?

Answer

Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate
Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate is a colorless to pale yellow liquid with a molecular weight of approximately 221.21 g/mol. It has a solubility of up to 12.5 g/100 mL in water and is soluble in common organic solvents. The compound exhibits moderate reactivity, particularly towards nucleophiles and can undergo polymerization under certain conditions.

About

English Name Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate
Molecular Formula C11H11FO3
Molecular Weight 210.20399999999998 g/mol
SMILES CCOC(=O)C=CC1=C(C=CC(=C1)F)O
InChIKey WPJUITWUKANQHJ-ZZXKWVIFSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

How is Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6) typically synthesized?

Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate is synthesized through the reaction of 5-fluoro-2-hy...

Compound Q&A

What industries use Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6)?

Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling Ethyl (2E)-3-(5-fluoro-2-hydroxyphenyl)acrylate (CAS: 949449-09-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What are the physical and chemical properties of Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is a crystalline soli...

69604-00-8Ethyl 5-nitro-1-benz...
2296719-34-9N-{3-[({2-[(4-Hydrox...
Compound Q&A

How should waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) be handled?

Waste containing Tetraamminepalladium(II) chloride hydrate (CAS: 13933-31-8) sho...

13933-31-8Tetraamminepalladium...
Compound Q&A

What are the main uses of 2-[7-(tert-Butyl)pyren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1270030-08-4)?

This compound is primarily used in organic synthesis, particularly for the prepa...

1270030-08-42-[7-(tert-Butyl)pyr...