Compound Q&A

What industries use 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5)?

Answer

2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5) is primarily used in the pharmaceutical industry for the synthesis of bioactive molecules, particularly in the development of drugs targeting various diseases. It is also utilized in the polymer industry for the synthesis of functional polymers and in the semiconductor industry for the production of advanced materials.

About

English Name 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Molecular Formula C12H19BO3
Molecular Weight 222.09 g/mol
SMILES Cc1oc(cc1C)B1OC(C(O1)(C)C)(C)C
InChIKey QRDSPWHVPCTWNF-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5)?

2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5) is a solid with...

Compound Q&A

How is 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5) typically synthesized?

2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5) is typically sy...

Compound Q&A

What precautions should be taken when handling 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5)?

When handling 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...