Compound Q&A

What are the physical and chemical properties of 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5)?

Answer

2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5) is a solid with a crystalline form. It has a molecular weight of approximately 256.37 g/mol. This compound is poorly soluble in water but soluble in organic solvents such as dichloromethane and acetonitrile. It exhibits typical reactivity of a dioxaborolane, which includes its ability to undergo Suzuki coupling reactions efficiently.

About

English Name 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Molecular Formula C12H19BO3
Molecular Weight 222.09 g/mol
SMILES Cc1oc(cc1C)B1OC(C(O1)(C)C)(C)C
InChIKey QRDSPWHVPCTWNF-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

How is 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5) typically synthesized?

2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5) is typically sy...

Compound Q&A

What industries use 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5)?

2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5) is primarily us...

Compound Q&A

What precautions should be taken when handling 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5)?

When handling 2-(4,5-Dimethyl-2-furyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 1073338-90-5), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...