Compound Q&A

What precautions should be taken when handling 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

Answer

2,2-Bis(trimethylsilyl)acetamide
When handling 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7), safety should be a top priority. Wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Store the compound in a well-ventilated area and avoid contact with water or other inorganic acids. In case of a spill, clean up using appropriate absorbent materials and dispose of the waste according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

CAS No 17879-45-7
English Name 2,2-Bis(trimethylsilyl)acetamide
Molecular Formula C8H21NOSi2
Molecular Weight 203.43 g/mol
SMILES C[Si](C)(C)C(C(=O)N)[Si](C)(C)C
InChIKey NDVMCQUOSYOQMZ-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) is a colorless, crystalline solid with a molecula...

Compound Q&A

How is 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) typically synthesized?

2,2-Bis(trimethylsilyl)acetamide is typically synthesized by the reaction of acetic anhydride with t...

Compound Q&A

What industries use 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) is widely used in various industries. It is an es...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...