Compound Q&A

How is 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) typically synthesized?

Answer

2,2-Bis(trimethylsilyl)acetamide
2,2-Bis(trimethylsilyl)acetamide is typically synthesized by the reaction of acetic anhydride with trimethylsilyl chloride in the presence of a base such as triethylamine. The reaction is carried out at room temperature, and the yield is usually around 90%. This method provides high selectivity and good purity of the product.

About

CAS No 17879-45-7
English Name 2,2-Bis(trimethylsilyl)acetamide
Molecular Formula C8H21NOSi2
Molecular Weight 203.43 g/mol
SMILES C[Si](C)(C)C(C(=O)N)[Si](C)(C)C
InChIKey NDVMCQUOSYOQMZ-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) is a colorless, crystalline solid with a molecula...

Compound Q&A

What industries use 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) is widely used in various industries. It is an es...

Compound Q&A

What precautions should be taken when handling 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

When handling 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7), safety should be a top priority. W...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...