Compound Q&A

How is 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) typically synthesized?

Answer

2,2-Bis(trimethylsilyl)acetamide
2,2-Bis(trimethylsilyl)acetamide is typically synthesized by the reaction of acetic anhydride with trimethylsilyl chloride in the presence of a base such as triethylamine. The reaction is carried out at room temperature, and the yield is usually around 90%. This method provides high selectivity and good purity of the product.

About

CAS No 17879-45-7
English Name 2,2-Bis(trimethylsilyl)acetamide
Molecular Formula C8H21NOSi2
Molecular Weight 203.43399999999994 g/mol
SMILES C[Si](C)(C)C(C(=O)N)[Si](C)(C)C
InChIKey NDVMCQUOSYOQMZ-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) is a colorless, crystalline solid with a molecula...

Compound Q&A

What industries use 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7) is widely used in various industries. It is an es...

Compound Q&A

What precautions should be taken when handling 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7)?

When handling 2,2-Bis(trimethylsilyl)acetamide (CAS: 17879-45-7), safety should be a top priority. W...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...